CAS 1639454-85-5 is the registry number for (1S,2S)-2-([(tert-Butoxy)carbonyl]amino)-1-fluorocyclobutane-1-carboxylic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
Cis-(1S,2S)-1-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid (CAS 1639454-85-5) is a chemical compound with the molecular formula C10H16FNO4 and a molecular weight of 233.24 g/mol. IUPAC name: cis-(1S,2S)-1-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid. InChIKey: HHODVUWEHKLBLG-WKEGUHRASA-N.
| Molecular formula | C10H16FNO4 |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | cis-(1S,2S)-1-fluoro-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclobutane-1-carboxylic acid |
| InChIKey | HHODVUWEHKLBLG-WKEGUHRASA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@]1(C(=O)O)F |
Computed by PubChem (NCBI)