CAS 1363382-00-6 appears in our catalog under these names: Methyl 1-boc-3-fluoroazetidine-3-carboxylate, 95%, 1-tert-Butyl 3-methyl 3-fluoroazetidine-1,3-dicarboxylate, 97%, 1-tert-butyl 3-methyl 3-fluoroazetidine-1,3-dicarboxylate, 97%, 97%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 250mg, 100mg, 10g, 25g, 5g, 1g.
1-O-tert-butyl 3-O-methyl 3-fluoroazetidine-1,3-dicarboxylate (CAS 1363382-00-6) is a chemical compound with the molecular formula C10H16FNO4 and a molecular weight of 233.24 g/mol. IUPAC name: 1-O-tert-butyl 3-O-methyl 3-fluoroazetidine-1,3-dicarboxylate. InChIKey: NBYZMANWZNNZDT-UHFFFAOYSA-N.
| Molecular formula | C10H16FNO4 |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 1-O-tert-butyl 3-O-methyl 3-fluoroazetidine-1,3-dicarboxylate |
| InChIKey | NBYZMANWZNNZDT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(C(=O)OC)F |
Computed by PubChem (NCBI)