CAS 1408074-68-9 appears in our catalog under these names: 1-Boc-3-fluoro-3-azetidineacetic acid, 95%, 2-(1-Boc-3-fluoroazetidin-3-yl)acetic acid, 1-Boc-3-fluoro-3-azetidineacetic acid, 97%, 97%, 1-BOC-3-FLUORO-3-AZETIDINEACETIC ACID, 97%. Offered by: Combi-blocks, Biosynth, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 50mg, 100mg, 250mg, 500mg.
2-[3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid (CAS 1408074-68-9) is a chemical compound with the molecular formula C10H16FNO4 and a molecular weight of 233.24 g/mol. IUPAC name: 2-[3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid. InChIKey: TZFKVZIUVDYNHJ-UHFFFAOYSA-N.
| Molecular formula | C10H16FNO4 |
|---|---|
| Molecular weight | 233.24 g/mol |
| IUPAC name | 2-[3-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]azetidin-3-yl]acetic acid |
| InChIKey | TZFKVZIUVDYNHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC(C1)(CC(=O)O)F |
Computed by PubChem (NCBI)