CAS 16401-27-7 is the registry number for 4-Hydrazinylcinnoline, 98%. Offered by: AmBeed. Available pack sizes: 5g, 10g.
Cinnolin-4-ylhydrazine (CAS 16401-27-7) is a chemical compound with the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. IUPAC name: cinnolin-4-ylhydrazine. InChIKey: HALUISOIGGICEW-UHFFFAOYSA-N.
| Molecular formula | C8H8N4 |
|---|---|
| Molecular weight | 160.18 g/mol |
| IUPAC name | cinnolin-4-ylhydrazine |
| InChIKey | HALUISOIGGICEW-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CN=N2)NN |
Computed by PubChem (NCBI)