CAS 164264-14-6 is the registry number for (-)-(3S)-3-{(tert-Butyl(dimethyl)silyl)oxy}dihydrofuran-2(3H)-one(>90%). Offered by: TRC. Available pack sizes: 1g, 2g, 500mg.
(3S)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-one (CAS 164264-14-6) is a chemical compound with the molecular formula C10H20O3Si and a molecular weight of 216.35 g/mol. IUPAC name: (3S)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-one. InChIKey: WNRXZIBXHZJOBE-QMMMGPOBSA-N.
| Molecular formula | C10H20O3Si |
|---|---|
| Molecular weight | 216.35 g/mol |
| IUPAC name | (3S)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-one |
| InChIKey | WNRXZIBXHZJOBE-QMMMGPOBSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1CCOC1=O |
Computed by PubChem (NCBI)