CAS 66753-64-8 appears in our catalog under these names: (METHACRYLOXYPROPYL)DIMETHYLMETHOXYSILANE, 97%, 97%, Methacryloxypropyldimethylmethoxysilane min 95%, 96%, 3-(Methoxydimethylsilyl)propyl methacrylate, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 50g, 100g, 250g.
3-[methoxy(dimethyl)silyl]propyl 2-methylprop-2-enoate (CAS 66753-64-8) is a chemical compound with the molecular formula C10H20O3Si and a molecular weight of 216.35 g/mol. IUPAC name: 3-[methoxy(dimethyl)silyl]propyl 2-methylprop-2-enoate. InChIKey: JBDMKOVTOUIKFI-UHFFFAOYSA-N.
| Molecular formula | C10H20O3Si |
|---|---|
| Molecular weight | 216.35 g/mol |
| IUPAC name | 3-[methoxy(dimethyl)silyl]propyl 2-methylprop-2-enoate |
| InChIKey | JBDMKOVTOUIKFI-UHFFFAOYSA-N |
| SMILES | CC(=C)C(=O)OCCC[Si](C)(C)OC |
Computed by PubChem (NCBI)