CAS 669000-31-1 appears in our catalog under these names: (R)-3-((tert-Butyldimethylsilyl)oxy)dihydrofuran-2(3H)-one, 97%, (+)-(3R)-3-{(tert-Butyl(dimethyl)silyl)oxy}dihydrofuran-2(3H)-one. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 0,25g, 0,5g, 1g, 2g, 5g.
(3R)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-one (CAS 669000-31-1) is a chemical compound with the molecular formula C10H20O3Si and a molecular weight of 216.35 g/mol. IUPAC name: (3R)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-one. InChIKey: WNRXZIBXHZJOBE-MRVPVSSYSA-N.
| Molecular formula | C10H20O3Si |
|---|---|
| Molecular weight | 216.35 g/mol |
| IUPAC name | (3R)-3-[tert-butyl(dimethyl)silyl]oxyoxolan-2-one |
| InChIKey | WNRXZIBXHZJOBE-MRVPVSSYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CCOC1=O |
Computed by PubChem (NCBI)