CAS 1643116-22-6 appears in our catalog under these names: Tenofovir Impurity 127, (R)-1-(6-Amino-3H-purin-3-yl)propan-2-ol, 98%, Tenofovir Impurity 117. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-1-(6-imino-7H-purin-3-yl)propan-2-ol (CAS 1643116-22-6) is a chemical compound with the molecular formula C8H11N5O and a molecular weight of 193.21 g/mol. IUPAC name: (2R)-1-(6-imino-7H-purin-3-yl)propan-2-ol. InChIKey: ULNYUKOBTPFIDK-RXMQYKEDSA-N.
| Molecular formula | C8H11N5O |
|---|---|
| Molecular weight | 193.21 g/mol |
| IUPAC name | (2R)-1-(6-imino-7H-purin-3-yl)propan-2-ol |
| InChIKey | ULNYUKOBTPFIDK-RXMQYKEDSA-N |
| SMILES | C[C@H](CN1C=NC(=N)C2=C1N=CN2)O |
Computed by PubChem (NCBI)