CAS 2560586-26-5 is the registry number for Valaciclovir Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.
(2R)-1-(6-aminopurin-7-yl)propan-2-ol (CAS 2560586-26-5) is a chemical compound with the molecular formula C8H11N5O and a molecular weight of 193.21 g/mol. IUPAC name: (2R)-1-(6-aminopurin-7-yl)propan-2-ol. InChIKey: GJQYTEXMDZPNSH-RXMQYKEDSA-N.
| Molecular formula | C8H11N5O |
|---|---|
| Molecular weight | 193.21 g/mol |
| IUPAC name | (2R)-1-(6-aminopurin-7-yl)propan-2-ol |
| InChIKey | GJQYTEXMDZPNSH-RXMQYKEDSA-N |
| SMILES | C[C@H](CN1C=NC2=NC=NC(=C21)N)O |
Computed by PubChem (NCBI)