CAS 164332-89-2 appears in our catalog under these names: Boc–D–Phe(4–NH2)–OH, Boc-D-Phe(4-NH2)-OH, 4-Amino-N-(tert-butoxycarbonyl)-D-phenylalanine, >97.0%(HPLC), 4-Amino-N-[(1,1-dimethylethoxy)carbonyl]-D-phenylalanine, 98%, 98%, Boc-4-Amino-D-Phe-OH, 97%. Offered by: GLPBio, Iris Biotech, TCI, Chemat, Fluorochem. Available pack sizes: 25g, 5g, 1g, 10g.
(2R)-3-(4-aminophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid (CAS 164332-89-2) is a chemical compound with the molecular formula C14H20N2O4 and a molecular weight of 280.32 g/mol. IUPAC name: (2R)-3-(4-aminophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid. InChIKey: NDMVQEZKACRLDP-LLVKDONJSA-N.
| Molecular formula | C14H20N2O4 |
|---|---|
| Molecular weight | 280.32 g/mol |
| IUPAC name | (2R)-3-(4-aminophenyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoic acid |
| InChIKey | NDMVQEZKACRLDP-LLVKDONJSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H](CC1=CC=C(C=C1)N)C(=O)O |
Computed by PubChem (NCBI)