Products 164365-16-6
CAS 164365-16-6 appears in our catalog under these names: N-Desmethyl Tamoxifen-d5, >95% (HPLC), N-Desmethyl tamoxifen-d5. Offered by: TRC, Biosynth, MedChemExpress. Available pack sizes: 10mg, 1mg, 2mg, 5mg, 10 mg, 1 mg.
N-methyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine (CAS 164365-16-6) is a chemical compound with the molecular formula C25H27NO and a molecular weight of 362.5 g/mol. IUPAC name: N-methyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine. InChIKey: NYDCDZSEEAUOHN-JZSWEIPSSA-N.
| Molecular formula | C25H27NO |
|---|---|
| Molecular weight | 362.5 g/mol |
| IUPAC name | N-methyl-2-[4-[(Z)-3,3,4,4,4-pentadeuterio-1,2-diphenylbut-1-enyl]phenoxy]ethanamine |
| InChIKey | NYDCDZSEEAUOHN-JZSWEIPSSA-N |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])/C(=C(\C1=CC=CC=C1)/C2=CC=C(C=C2)OCCNC)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)