CAS 31750-45-5 appears in our catalog under these names: (E)-2-(4-(1,2-Diphenyl-1-propenyl)phenoxy)-N,N-dimethyl-ethanamine, Tamoxifen Citrate Impurity D (as (E)-Isomer). Offered by: TRC, Mikromol. Available pack sizes: 25mg.
2-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-N,N-dimethylethanamine (CAS 31750-45-5) is a chemical compound with the molecular formula C25H27NO and a molecular weight of 357.5 g/mol. IUPAC name: 2-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-N,N-dimethylethanamine. InChIKey: YBZBQYHSLRTDHL-LKUDQCMESA-N.
| Molecular formula | C25H27NO |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | 2-[4-[(E)-1,2-diphenylprop-1-enyl]phenoxy]-N,N-dimethylethanamine |
| InChIKey | YBZBQYHSLRTDHL-LKUDQCMESA-N |
| SMILES | C/C(=C(/C1=CC=CC=C1)\C2=CC=C(C=C2)OCCN(C)C)/C3=CC=CC=C3 |
Computed by PubChem (NCBI)