CAS 213995-12-1 is the registry number for (R)-1,1,2-Triphenyl-2-(piperidin-1-yl)ethanol, 95%. Offered by: Combi-blocks. Available pack sizes: 1g.
(2R)-1,1,2-triphenyl-2-piperidin-1-ylethanol (CAS 213995-12-1) is a chemical compound with the molecular formula C25H27NO and a molecular weight of 357.5 g/mol. IUPAC name: (2R)-1,1,2-triphenyl-2-piperidin-1-ylethanol. InChIKey: BCFJVZGZDXPFBN-XMMPIXPASA-N.
| Molecular formula | C25H27NO |
|---|---|
| Molecular weight | 357.5 g/mol |
| IUPAC name | (2R)-1,1,2-triphenyl-2-piperidin-1-ylethanol |
| InChIKey | BCFJVZGZDXPFBN-XMMPIXPASA-N |
| SMILES | C1CCN(CC1)[C@H](C2=CC=CC=C2)C(C3=CC=CC=C3)(C4=CC=CC=C4)O |
Computed by PubChem (NCBI)