CAS 1643848-13-8 is the registry number for 4-(2-Benzoxazolyl)-N-phenylbenzenamine, 99%, 99%. Offered by: Chemat. Available pack sizes: 250mg, 1g, 5g.
4-(1,3-benzoxazol-2-yl)-N-phenylaniline (CAS 1643848-13-8) is a chemical compound with the molecular formula C19H14N2O and a molecular weight of 286.3 g/mol. IUPAC name: 4-(1,3-benzoxazol-2-yl)-N-phenylaniline. InChIKey: PNYBXIYYTZLEDJ-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 4-(1,3-benzoxazol-2-yl)-N-phenylaniline |
| InChIKey | PNYBXIYYTZLEDJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)NC2=CC=C(C=C2)C3=NC4=CC=CC=C4O3 |
Computed by PubChem (NCBI)