CAS 2095128-11-1 appears in our catalog under these names: (3aR,8aS)–2–(Quinolin–2–yl)–3a,8a–dihydro–8H–indeno(1,2–d)oxazole, (R,S)-In-Quinox, 97% 99%ee, 97% 99%ee, (3aR,8aS)-2-(Quinolin-2-yl)-3a,8a-dihydro-8H-indeno[1,2-d]oxazole, 96%. Offered by: GLPBio, Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g, 10g.
(3aS,8bR)-2-quinolin-2-yl-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazole (CAS 2095128-11-1) is a chemical compound with the molecular formula C19H14N2O and a molecular weight of 286.3 g/mol. IUPAC name: (3aS,8bR)-2-quinolin-2-yl-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazole. InChIKey: OYXOYKBPSDLDAZ-ZWKOTPCHSA-N.
| Molecular formula | C19H14N2O |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | (3aS,8bR)-2-quinolin-2-yl-4,8b-dihydro-3aH-indeno[1,2-d][1,3]oxazole |
| InChIKey | OYXOYKBPSDLDAZ-ZWKOTPCHSA-N |
| SMILES | C1[C@H]2[C@@H](C3=CC=CC=C31)N=C(O2)C4=NC5=CC=CC=C5C=C4 |
Computed by PubChem (NCBI)