CAS 93075-61-7 appears in our catalog under these names: 2-Biphenyl-4-yl-1,3-benzoxazol-5-amine, 95%, 2-((1,1'-Biphenyl)-4-yl)benzo(d)oxazol-5-amine, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 5g.
2-(4-phenylphenyl)-1,3-benzoxazol-5-amine (CAS 93075-61-7) is a chemical compound with the molecular formula C19H14N2O and a molecular weight of 286.3 g/mol. IUPAC name: 2-(4-phenylphenyl)-1,3-benzoxazol-5-amine. InChIKey: IANOMZFWVQGEPK-UHFFFAOYSA-N.
| Molecular formula | C19H14N2O |
|---|---|
| Molecular weight | 286.3 g/mol |
| IUPAC name | 2-(4-phenylphenyl)-1,3-benzoxazol-5-amine |
| InChIKey | IANOMZFWVQGEPK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)C3=NC4=C(O3)C=CC(=C4)N |
Computed by PubChem (NCBI)