CAS 164394-26-7 is the registry number for 5-Amino-1,10-phenanthroline-2,9-dicarboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
5-amino-1,10-phenanthroline-2,9-dicarboxylic acid (CAS 164394-26-7) is a chemical compound with the molecular formula C14H9N3O4 and a molecular weight of 283.24 g/mol. IUPAC name: 5-amino-1,10-phenanthroline-2,9-dicarboxylic acid. InChIKey: NCEKGOMZQFRXIW-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O4 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 5-amino-1,10-phenanthroline-2,9-dicarboxylic acid |
| InChIKey | NCEKGOMZQFRXIW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=C3C(=C(C=C21)N)C=CC(=N3)C(=O)O)C(=O)O |
Computed by PubChem (NCBI)