Products 82-33-7
CAS 82-33-7 is the registry number for Disperse violet 8. Offered by: MedChemExpress. Available pack sizes: Get quote.
1,4-diamino-5-nitroanthracene-9,10-dione (CAS 82-33-7) is a chemical compound with the molecular formula C14H9N3O4 and a molecular weight of 283.24 g/mol. IUPAC name: 1,4-diamino-5-nitroanthracene-9,10-dione. InChIKey: SDICTISQCKLMEB-UHFFFAOYSA-N.
| Molecular formula | C14H9N3O4 |
|---|---|
| Molecular weight | 283.24 g/mol |
| IUPAC name | 1,4-diamino-5-nitroanthracene-9,10-dione |
| InChIKey | SDICTISQCKLMEB-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C(=C1)[N+](=O)[O-])C(=O)C3=C(C=CC(=C3C2=O)N)N |
Computed by PubChem (NCBI)