Products 96983-28-7

CAS 96983-28-7 is the registry number for 2-{5,7-Dioxo-5H,6H,7H-pyrrolo(3,4-b)pyrazin-6-yl}-2-phenylacetic acid. Offered by: Biosynth. Available pack sizes: 5g, 0,5g.

Structural formula: {0} (CAS {1})

2-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)-2-phenylacetic acid (CAS 96983-28-7) is a chemical compound with the molecular formula C14H9N3O4 and a molecular weight of 283.24 g/mol. IUPAC name: 2-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)-2-phenylacetic acid. InChIKey: IHUIHFKBCYOUMW-UHFFFAOYSA-N.

Identity
Molecular formulaC14H9N3O4
Molecular weight283.24 g/mol
IUPAC name2-(5,7-dioxopyrrolo[3,4-b]pyrazin-6-yl)-2-phenylacetic acid
InChIKeyIHUIHFKBCYOUMW-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)C(C(=O)O)N2C(=O)C3=NC=CN=C3C2=O

Computed by PubChem (NCBI)