CAS 16444-19-2 is the registry number for Norglipin. Offered by: TRC. Available pack sizes: 10mg, 1mg.
[(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2,2-diphenylacetate (CAS 16444-19-2) is a chemical compound with the molecular formula C21H23NO3 and a molecular weight of 337.4 g/mol. IUPAC name: [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2,2-diphenylacetate. InChIKey: HIIVXBCWDPCZJA-DFNIBXOVSA-N.
| Molecular formula | C21H23NO3 |
|---|---|
| Molecular weight | 337.4 g/mol |
| IUPAC name | [(1S,5R)-8-azabicyclo[3.2.1]octan-3-yl] 2-hydroxy-2,2-diphenylacetate |
| InChIKey | HIIVXBCWDPCZJA-DFNIBXOVSA-N |
| SMILES | C1C[C@H]2CC(C[C@@H]1N2)OC(=O)C(C3=CC=CC=C3)(C4=CC=CC=C4)O |
Computed by PubChem (NCBI)