Products 1644449-83-1
CAS 1644449-83-1 appears in our catalog under these names: Deterenol acetate, Deterenol acetate, ISO 17034 RM, Deterenol acetate, 100 µg/ml in Methanol, ISO 17034 CRM. Offered by: Biosynth, HPC Standards. Available pack sizes: 25mg, 50mg, 100mg, 10mg, 1ml.
Acetic acid;4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenol (CAS 1644449-83-1) is a chemical compound with the molecular formula C13H21NO4 and a molecular weight of 255.31 g/mol. IUPAC name: acetic acid;4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenol. InChIKey: RQAISLPMVAAADT-UHFFFAOYSA-N.
| Molecular formula | C13H21NO4 |
|---|---|
| Molecular weight | 255.31 g/mol |
| IUPAC name | acetic acid;4-[1-hydroxy-2-(propan-2-ylamino)ethyl]phenol |
| InChIKey | RQAISLPMVAAADT-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(C1=CC=C(C=C1)O)O.CC(=O)O |
Computed by PubChem (NCBI)