Products 1644548-81-1
CAS 1644548-81-1 is the registry number for Methyl 6-(trifluoromethyl)pyrazine-2-carboxylate, 95%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 6-(trifluoromethyl)pyrazine-2-carboxylate (CAS 1644548-81-1) is a chemical compound with the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. IUPAC name: methyl 6-(trifluoromethyl)pyrazine-2-carboxylate. InChIKey: JBAABTQWFSTOFD-UHFFFAOYSA-N.
| Molecular formula | C7H5F3N2O2 |
|---|---|
| Molecular weight | 206.12 g/mol |
| IUPAC name | methyl 6-(trifluoromethyl)pyrazine-2-carboxylate |
| InChIKey | JBAABTQWFSTOFD-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CN=CC(=N1)C(F)(F)F |
Computed by PubChem (NCBI)