CAS 1644599-15-4 appears in our catalog under these names: Methyl 3-methyl-2-oxo-1,2,3,4-tetrahydroquinoxaline-5-carboxylate, 95%, Methyl 3-methyl-2-oxo-1,2,3,4-tetrahydroquinoxaline-5-carboxylate. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 50mg, 0,5g.
Methyl 3-methyl-2-oxo-3,4-dihydro-1H-quinoxaline-5-carboxylate (CAS 1644599-15-4) is a chemical compound with the molecular formula C11H12N2O3 and a molecular weight of 220.22 g/mol. IUPAC name: methyl 3-methyl-2-oxo-3,4-dihydro-1H-quinoxaline-5-carboxylate. InChIKey: MLODFKIYPKZFPL-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O3 |
|---|---|
| Molecular weight | 220.22 g/mol |
| IUPAC name | methyl 3-methyl-2-oxo-3,4-dihydro-1H-quinoxaline-5-carboxylate |
| InChIKey | MLODFKIYPKZFPL-UHFFFAOYSA-N |
| SMILES | CC1C(=O)NC2=CC=CC(=C2N1)C(=O)OC |
Computed by PubChem (NCBI)