Products 1646188-99-9

CAS 1646188-99-9 is the registry number for 2-Methylphenylboronic acid mida ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

6-methyl-2-(2-methylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1646188-99-9) is a chemical compound with the molecular formula C12H14BNO4 and a molecular weight of 247.06 g/mol. IUPAC name: 6-methyl-2-(2-methylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: YSHPENZDVGWTJJ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H14BNO4
Molecular weight247.06 g/mol
IUPAC name6-methyl-2-(2-methylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione
InChIKeyYSHPENZDVGWTJJ-UHFFFAOYSA-N
SMILESB1(OC(=O)CN(CC(=O)O1)C)C2=CC=CC=C2C

Computed by PubChem (NCBI)