CAS 1646189-01-6 is the registry number for 6-Methyl-2-(3-methylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.
6-methyl-2-(3-methylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione (CAS 1646189-01-6) is a chemical compound with the molecular formula C12H14BNO4 and a molecular weight of 247.06 g/mol. IUPAC name: 6-methyl-2-(3-methylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione. InChIKey: SHGWEHYNVYHMLA-UHFFFAOYSA-N.
| Molecular formula | C12H14BNO4 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | 6-methyl-2-(3-methylphenyl)-1,3,6,2-dioxazaborocane-4,8-dione |
| InChIKey | SHGWEHYNVYHMLA-UHFFFAOYSA-N |
| SMILES | B1(OC(=O)CN(CC(=O)O1)C)C2=CC(=CC=C2)C |
Computed by PubChem (NCBI)