Products 850567-32-7
CAS 850567-32-7 appears in our catalog under these names: 3-(4-Oxopiperidine-1-carbonyl)phenylboronic acid, 97%, 3-(4-Oxopiperidine-1-carbonyl)phenylboronic acid. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 10g, 1g, 500mg, 1000mg, 2000mg.
[3-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid (CAS 850567-32-7) is a chemical compound with the molecular formula C12H14BNO4 and a molecular weight of 247.06 g/mol. IUPAC name: [3-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid. InChIKey: ATSICDGBVQTFMX-UHFFFAOYSA-N.
| Molecular formula | C12H14BNO4 |
|---|---|
| Molecular weight | 247.06 g/mol |
| IUPAC name | [3-(4-oxopiperidine-1-carbonyl)phenyl]boronic acid |
| InChIKey | ATSICDGBVQTFMX-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(=O)N2CCC(=O)CC2)(O)O |
Computed by PubChem (NCBI)