Products 1646526-10-4
CAS 1646526-10-4 is the registry number for H2S Fluorescent Probe, P3 1PC X 5MG. Offered by: Sigma-Aldrich. Available pack sizes: 5MG.
2-[(E)-3-[6-(2-hydroxyethylamino)naphthalen-2-yl]-3-oxoprop-1-enyl]-3,5-dimethoxybenzaldehyde (CAS 1646526-10-4) is a chemical compound with the molecular formula C24H23NO5 and a molecular weight of 405.4 g/mol. IUPAC name: 2-[(E)-3-[6-(2-hydroxyethylamino)naphthalen-2-yl]-3-oxoprop-1-enyl]-3,5-dimethoxybenzaldehyde. InChIKey: AASGCGDEYNAMCY-BQYQJAHWSA-N.
| Molecular formula | C24H23NO5 |
|---|---|
| Molecular weight | 405.4 g/mol |
| IUPAC name | 2-[(E)-3-[6-(2-hydroxyethylamino)naphthalen-2-yl]-3-oxoprop-1-enyl]-3,5-dimethoxybenzaldehyde |
| InChIKey | AASGCGDEYNAMCY-BQYQJAHWSA-N |
| SMILES | COC1=CC(=C(C(=C1)OC)/C=C/C(=O)C2=CC3=C(C=C2)C=C(C=C3)NCCO)C=O |
Computed by PubChem (NCBI)