Products 16470-61-4

CAS 16470-61-4 is the registry number for N-[(4-Methylphenyl)sulfonyl]-n-(3-nitrophenyl)glycine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-(N-(4-methylphenyl)sulfonyl-3-nitroanilino)acetic acid (CAS 16470-61-4) is a chemical compound with the molecular formula C15H14N2O6S and a molecular weight of 350.3 g/mol. IUPAC name: 2-(N-(4-methylphenyl)sulfonyl-3-nitroanilino)acetic acid. InChIKey: OIKCVEHFZIFXGJ-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14N2O6S
Molecular weight350.3 g/mol
IUPAC name2-(N-(4-methylphenyl)sulfonyl-3-nitroanilino)acetic acid
InChIKeyOIKCVEHFZIFXGJ-UHFFFAOYSA-N
SMILESCC1=CC=C(C=C1)S(=O)(=O)N(CC(=O)O)C2=CC(=CC=C2)[N+](=O)[O-]

Computed by PubChem (NCBI)