CAS 380569-47-1 is the registry number for 2-(3,4-Dimethyl-5-nitro-benzenesulfonylamino)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
2-[(3,4-dimethyl-5-nitrophenyl)sulfonylamino]benzoic acid (CAS 380569-47-1) is a chemical compound with the molecular formula C15H14N2O6S and a molecular weight of 350.3 g/mol. IUPAC name: 2-[(3,4-dimethyl-5-nitrophenyl)sulfonylamino]benzoic acid. InChIKey: SMERULCGQGCLRE-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O6S |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 2-[(3,4-dimethyl-5-nitrophenyl)sulfonylamino]benzoic acid |
| InChIKey | SMERULCGQGCLRE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)[N+](=O)[O-])S(=O)(=O)NC2=CC=CC=C2C(=O)O |
Computed by PubChem (NCBI)