Products 380569-47-1

CAS 380569-47-1 is the registry number for 2-(3,4-Dimethyl-5-nitro-benzenesulfonylamino)-benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

2-[(3,4-dimethyl-5-nitrophenyl)sulfonylamino]benzoic acid (CAS 380569-47-1) is a chemical compound with the molecular formula C15H14N2O6S and a molecular weight of 350.3 g/mol. IUPAC name: 2-[(3,4-dimethyl-5-nitrophenyl)sulfonylamino]benzoic acid. InChIKey: SMERULCGQGCLRE-UHFFFAOYSA-N.

Identity
Molecular formulaC15H14N2O6S
Molecular weight350.3 g/mol
IUPAC name2-[(3,4-dimethyl-5-nitrophenyl)sulfonylamino]benzoic acid
InChIKeySMERULCGQGCLRE-UHFFFAOYSA-N
SMILESCC1=CC(=CC(=C1C)[N+](=O)[O-])S(=O)(=O)NC2=CC=CC=C2C(=O)O

Computed by PubChem (NCBI)