Products 554426-69-6
CAS 554426-69-6 appears in our catalog under these names: Sulpiride Impurity 10, Sulpiride Impurity 29. Offered by: Hubei YoungXin. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg.
5-[(4-acetamidophenyl)sulfamoyl]-2-hydroxybenzoic acid (CAS 554426-69-6) is a chemical compound with the molecular formula C15H14N2O6S and a molecular weight of 350.3 g/mol. IUPAC name: 5-[(4-acetamidophenyl)sulfamoyl]-2-hydroxybenzoic acid. InChIKey: CZFKVINQDIIZMI-UHFFFAOYSA-N.
| Molecular formula | C15H14N2O6S |
|---|---|
| Molecular weight | 350.3 g/mol |
| IUPAC name | 5-[(4-acetamidophenyl)sulfamoyl]-2-hydroxybenzoic acid |
| InChIKey | CZFKVINQDIIZMI-UHFFFAOYSA-N |
| SMILES | CC(=O)NC1=CC=C(C=C1)NS(=O)(=O)C2=CC(=C(C=C2)O)C(=O)O |
Computed by PubChem (NCBI)