Products 1647113-98-1
CAS 1647113-98-1 is the registry number for 2-Hydroxy-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde, 98%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
2-hydroxy-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde (CAS 1647113-98-1) is a chemical compound with the molecular formula C14H19BO5 and a molecular weight of 278.11 g/mol. IUPAC name: 2-hydroxy-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde. InChIKey: IUAGSVFWOYFPKG-UHFFFAOYSA-N.
| Molecular formula | C14H19BO5 |
|---|---|
| Molecular weight | 278.11 g/mol |
| IUPAC name | 2-hydroxy-4-methoxy-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzaldehyde |
| InChIKey | IUAGSVFWOYFPKG-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2OC)O)C=O |
Computed by PubChem (NCBI)