CAS 1647150-35-3 is the registry number for 4-(2-Chlorophenyl)-6-nitroquinazoline. Offered by: Mikromol. Available pack sizes: 25mg.
4-(2-chlorophenyl)-6-nitroquinazoline (CAS 1647150-35-3) is a chemical compound with the molecular formula C14H8ClN3O2 and a molecular weight of 285.68 g/mol. IUPAC name: 4-(2-chlorophenyl)-6-nitroquinazoline. InChIKey: QPMDSQWZDIXPLJ-UHFFFAOYSA-N.
| Molecular formula | C14H8ClN3O2 |
|---|---|
| Molecular weight | 285.68 g/mol |
| IUPAC name | 4-(2-chlorophenyl)-6-nitroquinazoline |
| InChIKey | QPMDSQWZDIXPLJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)C2=NC=NC3=C2C=C(C=C3)[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)