Products 380423-28-9
CAS 380423-28-9 is the registry number for WAY-606344. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4-chlorophenyl)-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone (CAS 380423-28-9) is a chemical compound with the molecular formula C14H8ClN3O2 and a molecular weight of 285.68 g/mol. IUPAC name: (4-chlorophenyl)-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone. InChIKey: BEHPDWUBHLTQQO-UHFFFAOYSA-N.
| Molecular formula | C14H8ClN3O2 |
|---|---|
| Molecular weight | 285.68 g/mol |
| IUPAC name | (4-chlorophenyl)-(5-pyridin-4-yl-1,3,4-oxadiazol-2-yl)methanone |
| InChIKey | BEHPDWUBHLTQQO-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C(=O)C2=NN=C(O2)C3=CC=NC=C3)Cl |
Computed by PubChem (NCBI)