CAS 91961-09-0 appears in our catalog under these names: 4-Chloro-2-(2-nitrophenyl)quinazoline, 95%, 4–chloro–2–(2–nitrophenyl)quinazoline. Offered by: AmBeed, GLPBio. Available pack sizes: 1g, 100mg, 250mg.
4-chloro-2-(2-nitrophenyl)quinazoline (CAS 91961-09-0) is a chemical compound with the molecular formula C14H8ClN3O2 and a molecular weight of 285.68 g/mol. IUPAC name: 4-chloro-2-(2-nitrophenyl)quinazoline. InChIKey: BIHCDKXSYZRVRB-UHFFFAOYSA-N.
| Molecular formula | C14H8ClN3O2 |
|---|---|
| Molecular weight | 285.68 g/mol |
| IUPAC name | 4-chloro-2-(2-nitrophenyl)quinazoline |
| InChIKey | BIHCDKXSYZRVRB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=NC(=N2)C3=CC=CC=C3[N+](=O)[O-])Cl |
Computed by PubChem (NCBI)