CAS 1648891-88-6 is the registry number for 4-Detrifluoroethoxy-4-methylsulfonyl Lansoprazole Sulfone. Offered by: TRC. Available pack sizes: 100mg.
2-[(3-methyl-4-methylsulfonyl-2-pyridinyl)methylsulfonyl]-1H-benzimidazole (CAS 1648891-88-6) is a chemical compound with the molecular formula C15H15N3O4S2 and a molecular weight of 365.4 g/mol. IUPAC name: 2-[(3-methyl-4-methylsulfonyl-2-pyridinyl)methylsulfonyl]-1H-benzimidazole. InChIKey: QQCSDGJNWMIXOY-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O4S2 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 2-[(3-methyl-4-methylsulfonyl-2-pyridinyl)methylsulfonyl]-1H-benzimidazole |
| InChIKey | QQCSDGJNWMIXOY-UHFFFAOYSA-N |
| SMILES | CC1=C(C=CN=C1CS(=O)(=O)C2=NC3=CC=CC=C3N2)S(=O)(=O)C |
Computed by PubChem (NCBI)