CAS 326903-74-6 is the registry number for N'-(1,1-Dioxido-1,2-benzisothiazol-3-yl)-2,4-dimethylbenzenesulfonohydrazide, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
N'-(1,1-dioxo-1,2-benzothiazol-3-yl)-2,4-dimethylbenzenesulfonohydrazide (CAS 326903-74-6) is a chemical compound with the molecular formula C15H15N3O4S2 and a molecular weight of 365.4 g/mol. IUPAC name: N'-(1,1-dioxo-1,2-benzothiazol-3-yl)-2,4-dimethylbenzenesulfonohydrazide. InChIKey: QARULBNZWNDVPO-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O4S2 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | N'-(1,1-dioxo-1,2-benzothiazol-3-yl)-2,4-dimethylbenzenesulfonohydrazide |
| InChIKey | QARULBNZWNDVPO-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)S(=O)(=O)NNC2=NS(=O)(=O)C3=CC=CC=C32)C |
Computed by PubChem (NCBI)