Products 892395-41-4
CAS 892395-41-4 appears in our catalog under these names: Meloxicam Impurity 13, Amido Methyl Meloxicam (Meloxicam Impurity), >95% (HPLC), Amido methyl meloxicam. Offered by: Hubei YoungXin, TRC, Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 200mg, 1mg, 2,5mg, 2mg.
4-hydroxy-N,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxamide (CAS 892395-41-4) is a chemical compound with the molecular formula C15H15N3O4S2 and a molecular weight of 365.4 g/mol. IUPAC name: 4-hydroxy-N,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxamide. InChIKey: GEXSYKOSERXHIX-UHFFFAOYSA-N.
| Molecular formula | C15H15N3O4S2 |
|---|---|
| Molecular weight | 365.4 g/mol |
| IUPAC name | 4-hydroxy-N,2-dimethyl-N-(5-methyl-1,3-thiazol-2-yl)-1,1-dioxo-1lambda6,2-benzothiazine-3-carboxamide |
| InChIKey | GEXSYKOSERXHIX-UHFFFAOYSA-N |
| SMILES | CC1=CN=C(S1)N(C)C(=O)C2=C(C3=CC=CC=C3S(=O)(=O)N2C)O |
Computed by PubChem (NCBI)