Products 1648893-21-3
CAS 1648893-21-3 appears in our catalog under these names: Nitracaine, Nitracaine, 98.95%. Offered by: GLPBio, Biosynth, MedChemExpress. Available pack sizes: 1mg, 10mg, 5mg, 10 mg, 1 mg, 5 mg.
[3-(diethylamino)-2,2-dimethylpropyl] 4-nitrobenzoate (CAS 1648893-21-3) is a chemical compound with the molecular formula C16H24N2O4 and a molecular weight of 308.37 g/mol. IUPAC name: [3-(diethylamino)-2,2-dimethylpropyl] 4-nitrobenzoate. InChIKey: SPTIETJWCCCJSE-UHFFFAOYSA-N.
| Molecular formula | C16H24N2O4 |
|---|---|
| Molecular weight | 308.37 g/mol |
| IUPAC name | [3-(diethylamino)-2,2-dimethylpropyl] 4-nitrobenzoate |
| InChIKey | SPTIETJWCCCJSE-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC(C)(C)COC(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)
Synonyms:
Nitracaine, p-Nitrobenzoic acid 2,2-dimethyl-3-(diethylamino)propyl ester, 4-Nitrobenzoic acid 3-(diethylamino)-2,2-dimethylpropyl ester, 3-(diethylamino)-2,2-dimethylpropyl 4-nitrobenzoate, [3-(diethylamino)-2,2-dimethylpropyl] 4-nitrobenzoate, orb2945815, [3-(diethylamino)-2,2-dimethyl-propyl] 4-nitrobenzoate