Products 1649454-38-5
CAS 1649454-38-5 appears in our catalog under these names: 5-bromo-3,3-dimethyl-1H,2H,3H-pyrrolo[3,2-b]pyridin-2-one, 97%, 97%, 5-Bromo-3,3-dimethyl-1H,2H,3H-pyrrolo[3,2-b]pyridin-2-one, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 500mg.
5-bromo-3,3-dimethyl-1H-pyrrolo[3,2-b]pyridin-2-one (CAS 1649454-38-5) is a chemical compound with the molecular formula C9H9BrN2O and a molecular weight of 241.08 g/mol. IUPAC name: 5-bromo-3,3-dimethyl-1H-pyrrolo[3,2-b]pyridin-2-one. InChIKey: OQTXMUJCSNKYCR-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O |
|---|---|
| Molecular weight | 241.08 g/mol |
| IUPAC name | 5-bromo-3,3-dimethyl-1H-pyrrolo[3,2-b]pyridin-2-one |
| InChIKey | OQTXMUJCSNKYCR-UHFFFAOYSA-N |
| SMILES | CC1(C2=C(C=CC(=N2)Br)NC1=O)C |
Computed by PubChem (NCBI)