CAS 164991-68-8 is the registry number for Decumbenine B. Offered by: TRC, Biosynth. Available pack sizes: 100mg, 10mg, 5mg, 25mg, 50mg.
[5-([1,3]dioxolo[4,5-f]isoquinolin-8-yl)-1,3-benzodioxol-4-yl]methanol (CAS 164991-68-8) is a chemical compound with the molecular formula C18H13NO5 and a molecular weight of 323.3 g/mol. IUPAC name: [5-([1,3]dioxolo[4,5-f]isoquinolin-8-yl)-1,3-benzodioxol-4-yl]methanol. InChIKey: GKOMWDNIMJHCDB-UHFFFAOYSA-N.
| Molecular formula | C18H13NO5 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | [5-([1,3]dioxolo[4,5-f]isoquinolin-8-yl)-1,3-benzodioxol-4-yl]methanol |
| InChIKey | GKOMWDNIMJHCDB-UHFFFAOYSA-N |
| SMILES | C1OC2=C(O1)C3=CC(=NC=C3C=C2)C4=C(C5=C(C=C4)OCO5)CO |
Computed by PubChem (NCBI)