CAS 3062867-16-4 is the registry number for HDAC6-IN-71. Offered by: MedChemExpress. Available pack sizes: Get quote.
(E)-N-hydroxy-3-[4-(2-oxochromen-4-yl)oxyphenyl]prop-2-enamide (CAS 3062867-16-4) is a chemical compound with the molecular formula C18H13NO5 and a molecular weight of 323.3 g/mol. IUPAC name: (E)-N-hydroxy-3-[4-(2-oxochromen-4-yl)oxyphenyl]prop-2-enamide. InChIKey: QEDGEHHFKCTOPP-JXMROGBWSA-N.
| Molecular formula | C18H13NO5 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | (E)-N-hydroxy-3-[4-(2-oxochromen-4-yl)oxyphenyl]prop-2-enamide |
| InChIKey | QEDGEHHFKCTOPP-JXMROGBWSA-N |
| SMILES | C1=CC=C2C(=C1)C(=CC(=O)O2)OC3=CC=C(C=C3)/C=C/C(=O)NO |
Computed by PubChem (NCBI)