CAS 250641-16-8 appears in our catalog under these names: 6-(Benzyloxy)quinoline-2,4-dicarboxylic acid, 95%, 6-(Benzyloxy)quinoline-2,4-dicarboxylic acid, 97%, 6–(Benzyloxy)quinoline–2,4–dicarboxylic acid. Offered by: Combi-blocks, AmBeed, GLPBio. Available pack sizes: 250mg, 1g, 100mg.
6-phenylmethoxyquinoline-2,4-dicarboxylic acid (CAS 250641-16-8) is a chemical compound with the molecular formula C18H13NO5 and a molecular weight of 323.3 g/mol. IUPAC name: 6-phenylmethoxyquinoline-2,4-dicarboxylic acid. InChIKey: TVYZHPKNCIDPQV-UHFFFAOYSA-N.
| Molecular formula | C18H13NO5 |
|---|---|
| Molecular weight | 323.3 g/mol |
| IUPAC name | 6-phenylmethoxyquinoline-2,4-dicarboxylic acid |
| InChIKey | TVYZHPKNCIDPQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC3=C(C=C2)N=C(C=C3C(=O)O)C(=O)O |
Computed by PubChem (NCBI)