CAS 16502-08-2 appears in our catalog under these names: 5-Benzyl-1,3,4-thiadiazol-2-amine, 95%, 5-Benzyl-1,3,4-thiadiazol-2-amine, 98%, 5-Benzyl-1,3,4-thiadiazol-2-amine, 98%, 98%. Offered by: Combi-blocks, Fluorochem, Chemat. Available pack sizes: 1g, 5g, 250mg, 100mg, 25g.
5-benzyl-1,3,4-thiadiazol-2-amine (CAS 16502-08-2) is a chemical compound with the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. IUPAC name: 5-benzyl-1,3,4-thiadiazol-2-amine. InChIKey: HKTCSEFOSVTSQV-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S |
|---|---|
| Molecular weight | 191.26 g/mol |
| IUPAC name | 5-benzyl-1,3,4-thiadiazol-2-amine |
| InChIKey | HKTCSEFOSVTSQV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NN=C(S2)N |
Computed by PubChem (NCBI)