CAS 28384-40-9 is the registry number for 5-Benzyl-2,3-dihydro-1h-1,2,4-triazole-3-thione, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.
5-benzyl-1,2-dihydro-1,2,4-triazole-3-thione (CAS 28384-40-9) is a chemical compound with the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. IUPAC name: 5-benzyl-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: MAGFPLALYSZUTR-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S |
|---|---|
| Molecular weight | 191.26 g/mol |
| IUPAC name | 5-benzyl-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | MAGFPLALYSZUTR-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC2=NC(=S)NN2 |
Computed by PubChem (NCBI)