CAS 64310-34-5 appears in our catalog under these names: 5-(4-Methylphenyl)-4h-1,2,4-triazole-3-thiol, 95%, 3-(p-Tolyl)-1H-1,2,4-triazole-5-thiol, 97%, 5-(4-Methylphenyl)-4H-1,2,4-triazole-3-thiol. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 1g, 25g, 10g, 5g, 0,5g.
5-(4-methylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione (CAS 64310-34-5) is a chemical compound with the molecular formula C9H9N3S and a molecular weight of 191.26 g/mol. IUPAC name: 5-(4-methylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione. InChIKey: DEVMOFPQIPHPDM-UHFFFAOYSA-N.
| Molecular formula | C9H9N3S |
|---|---|
| Molecular weight | 191.26 g/mol |
| IUPAC name | 5-(4-methylphenyl)-1,2-dihydro-1,2,4-triazole-3-thione |
| InChIKey | DEVMOFPQIPHPDM-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=NC(=S)NN2 |
Computed by PubChem (NCBI)