Products 165105-40-8
CAS 165105-40-8 appears in our catalog under these names: 3-(6-bromopyridin-2-yl)propanoic acid, 97%, 97%, 3-(6-Bromopyridin-2-yl)propanoic acid, 98%. Offered by: Chemat, Ambeed. Available pack sizes: 1g, 5g, 10g, 250mg, 100mg.
3-(6-bromo-2-pyridinyl)propanoic acid (CAS 165105-40-8) is a chemical compound with the molecular formula C8H8BrNO2 and a molecular weight of 230.06 g/mol. IUPAC name: 3-(6-bromo-2-pyridinyl)propanoic acid. InChIKey: MRHGAMBYYFLQHW-UHFFFAOYSA-N.
| Molecular formula | C8H8BrNO2 |
|---|---|
| Molecular weight | 230.06 g/mol |
| IUPAC name | 3-(6-bromo-2-pyridinyl)propanoic acid |
| InChIKey | MRHGAMBYYFLQHW-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1)Br)CCC(=O)O |
Computed by PubChem (NCBI)