CAS 165112-03-8 appears in our catalog under these names: 7–Hydroxy–2–methylquinoline, 2-Methylquinolin-7-ol 95%, 2-Methylquinolin-7-ol, 95%, 95%, 2-Methylquinolin-7-ol, 97%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g.
2-methylquinolin-7-ol (CAS 165112-03-8) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 2-methylquinolin-7-ol. InChIKey: MUDWVGFCPWBBEP-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 2-methylquinolin-7-ol |
| InChIKey | MUDWVGFCPWBBEP-UHFFFAOYSA-N |
| SMILES | CC1=NC2=C(C=C1)C=CC(=C2)O |
Computed by PubChem (NCBI)