Products 16519-25-8

CAS 16519-25-8 is the registry number for (E)-Cinnamyl phenyl ether, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 2,5g, 5g, 10g, 25g, 50g.

Structural formula: {0} (CAS {1})

[(E)-3-phenoxyprop-1-enyl]benzene (CAS 16519-25-8) is a chemical compound with the molecular formula C15H14O and a molecular weight of 210.27 g/mol. IUPAC name: [(E)-3-phenoxyprop-1-enyl]benzene. InChIKey: LLOUPYJHSJUFQI-JXMROGBWSA-N.

Identity
Molecular formulaC15H14O
Molecular weight210.27 g/mol
IUPAC name[(E)-3-phenoxyprop-1-enyl]benzene
InChIKeyLLOUPYJHSJUFQI-JXMROGBWSA-N
SMILESC1=CC=C(C=C1)/C=C/COC2=CC=CC=C2

Computed by PubChem (NCBI)