CAS 165259-91-6 appears in our catalog under these names: Milnacipran Methyl Amine Impurity HCl, rac,cis-Milnacipran Hydrochloride. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 500mg.
Cis-(1R,2S)-N,N-diethyl-2-(methylaminomethyl)-1-phenylcyclopropane-1-carboxamide;hydrochloride (CAS 165259-91-6) is a chemical compound with the molecular formula C16H25ClN2O and a molecular weight of 296.83 g/mol. IUPAC name: cis-(1R,2S)-N,N-diethyl-2-(methylaminomethyl)-1-phenylcyclopropane-1-carboxamide;hydrochloride. InChIKey: SCNNGOIUMUZQEQ-XMZRARIVSA-N.
| Molecular formula | C16H25ClN2O |
|---|---|
| Molecular weight | 296.83 g/mol |
| IUPAC name | cis-(1R,2S)-N,N-diethyl-2-(methylaminomethyl)-1-phenylcyclopropane-1-carboxamide;hydrochloride |
| InChIKey | SCNNGOIUMUZQEQ-XMZRARIVSA-N |
| SMILES | CCN(CC)C(=O)[C@@]1(C[C@@H]1CNC)C2=CC=CC=C2.Cl |
Computed by PubChem (NCBI)