Products 221264-33-1

CAS 221264-33-1 is the registry number for Ropinirole EP Impurity B HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[2-(2-methylpentylamino)ethyl]-1,3-dihydroindol-2-one;hydrochloride (CAS 221264-33-1) is a chemical compound with the molecular formula C16H25ClN2O and a molecular weight of 296.83 g/mol. IUPAC name: 4-[2-(2-methylpentylamino)ethyl]-1,3-dihydroindol-2-one;hydrochloride. InChIKey: JOGZDWYHUIGZLI-UHFFFAOYSA-N.

Identity
Molecular formulaC16H25ClN2O
Molecular weight296.83 g/mol
IUPAC name4-[2-(2-methylpentylamino)ethyl]-1,3-dihydroindol-2-one;hydrochloride
InChIKeyJOGZDWYHUIGZLI-UHFFFAOYSA-N
SMILESCCCC(C)CNCCC1=C2CC(=O)NC2=CC=C1.Cl

Computed by PubChem (NCBI)